C22H28F3N5O — CID 172516751
6-[4-(4-pentoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 172516751) has the molecular formula C22H28F3N5O and a molecular weight of 435.49 g/mol. Its IUPAC name is 6-[4-(4-pentoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[4-(4-pentoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 172516751 |
| Molecular Formula | C22H28F3N5O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 6-[4-(4-pentoxyphenyl)piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CCCCCOc1ccc(C2CCN(C3=Nn4c(nnc4C(F)(F)F)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H28F3N5O/c1-2-3-4-15-31-18-7-5-16(6-8-18)17-11-13-29(14-12-17)20-10-9-19-26-27-21(22(23,24)25)30(19)28-20/h5-8,17H,2-4,9-15H2,1H3 |
| InChIKey | PMOWUNSMCKIRCB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|