C31H18F6N4O3 — CID 172517412
1-[2-[4-[6-[3,5-bis(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one (PubChem CID 172517412) has the molecular formula C31H18F6N4O3 and a molecular weight of 608.50 g/mol. Its IUPAC name is 1-[2-[4-[6-[3,5-bis(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one.
| Compound Name | 1-[2-[4-[6-[3,5-bis(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one |
|---|---|
| PubChem CID | 172517412 |
| Molecular Formula | C31H18F6N4O3 |
| Molecular Weight | 608.50 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 1-[2-[4-[6-[3,5-bis(trifluoromethyl)phenyl]-3-pyridinyl]phenyl]-4,5-bis(2-oxoaziridin-1-yl)phenyl]aziridin-2-one |
| SMILES | O=C1CN1c1cc(N2CC2=O)c(N2CC2=O)cc1-c1ccc(-c2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc2)cc1 |
| InChI | InChI=1S/C31H18F6N4O3/c32-30(33,34)20-7-19(8-21(9-20)31(35,36)37)23-6-5-18(12-38-23)16-1-3-17(4-2-16)22-10-25(40-14-28(40)43)26(41-15-29(41)44)11-24(22)39-13-27(39)42/h1-12H,13-15H2 |
| InChIKey | PAXSDLJTBDMOOK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|