C35H55NO6S — CID 172517472
2-[benzyl-[4-(6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid (PubChem CID 172517472) has the molecular formula C35H55NO6S and a molecular weight of 617.89 g/mol. Its IUPAC name is 2-[benzyl-[4-(6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[benzyl-[4-(6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 172517472 |
| Molecular Formula | C35H55NO6S |
| Molecular Weight | 617.89 g/mol |
| Exact Mass | 617.38 |
| IUPAC Name | 2-[benzyl-[4-(6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid |
| SMILES | CCC1C(O)C2C3CCC(C(C)CCC(=O)N(CCS(=O)(=O)O)Cc4ccccc4)C3(C)CCC2C2(C)CCC(O)CC12 |
| InChI | InChI=1S/C35H55NO6S/c1-5-26-30-21-25(37)15-17-35(30,4)29-16-18-34(3)27(12-13-28(34)32(29)33(26)39)23(2)11-14-31(38)36(19-20-43(40,41)42)22-24-9-7-6-8-10-24/h6-10,23,25-30,32-33,37,39H,5,11-22H2,1-4H3,(H,40,41,42) |
| InChIKey | RBWXFDFSNNOHJA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.89 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|