C28H48N2O7S — CID 172517540
2-[(2-amino-2-oxoethyl)-[4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid (PubChem CID 172517540) has the molecular formula C28H48N2O7S and a molecular weight of 556.77 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 172517540 |
| Molecular Formula | C28H48N2O7S |
| Molecular Weight | 556.77 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid |
| SMILES | CC(CCC(=O)N(CCS(=O)(=O)O)CC(N)=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C28H48N2O7S/c1-17(4-9-26(34)30(16-25(29)33)12-13-38(35,36)37)21-7-8-22-20-6-5-18-14-19(31)10-11-27(18,2)23(20)15-24(32)28(21,22)3/h17-24,31-32H,4-16H2,1-3H3,(H2,29,33)(H,35,36,37) |
| InChIKey | RXQGEZDPDHGIBM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.77 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|