About 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine
1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine (PubChem CID 172518189) has the molecular formula C22H45NO3
and a molecular weight of 371.61 g/mol. Its IUPAC name is 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine |
| PubChem CID | 172518189 |
| Molecular Formula | C22H45NO3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.34 |
| IUPAC Name | 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine |
| SMILES | CC(C)(C)OCC1C(OC(C)(C)C)C(OC(C)(C)C)CCN1C(C)(C)C |
| InChI | InChI=1S/C22H45NO3/c1-19(2,3)23-14-13-17(25-21(7,8)9)18(26-22(10,11)12)16(23)15-24-20(4,5)6/h16-18H,13-15H2,1-12H3 |
| InChIKey | VAHMZGHYZXNSNL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine?
The IUPAC name of 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine (CID 172518189) is 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine.
What is the SMILES notation for 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine?
The canonical SMILES for 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine is CC(C)(C)OCC1C(OC(C)(C)C)C(OC(C)(C)C)CCN1C(C)(C)C.
What is the InChIKey of 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine?
The InChIKey is VAHMZGHYZXNSNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45NO3/c1-19(2,3)23-14-13-17(25-21(7,8)9)18(26-22(10,11)12)16(23)15-24-20(4,5)6/h16-18H,13-15H2,1-12H3.
What are the key properties of 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine?
1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine has a molecular weight of 371.61 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,4-bis[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxymethyl]piperidine is sourced from PubChem (CID 172518189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).