C24H25N5O2 — CID 172521331
2-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]benzoic acid (PubChem CID 172521331) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]benzoic acid.
| Compound Name | 2-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 172521331 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-[[(1R)-1-(2-cyano-7-methyl-3-piperidin-4-ylquinoxalin-5-yl)ethyl]amino]benzoic acid |
| SMILES | Cc1cc([C@@H](C)Nc2ccccc2C(=O)O)c2nc(C3CCNCC3)c(C#N)nc2c1 |
| InChI | InChI=1S/C24H25N5O2/c1-14-11-18(15(2)27-19-6-4-3-5-17(19)24(30)31)23-20(12-14)28-21(13-25)22(29-23)16-7-9-26-10-8-16/h3-6,11-12,15-16,26-27H,7-10H2,1-2H3,(H,30,31)/t15-/m1/s1 |
| InChIKey | JLGRIMYQFURLJH-OAHLLOKOSA-N |
| XLogP | 4.15 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |