C35H41BrN8O3Si — CID 172523054
5-azido-2-[(4-bromo-2,6-dimethoxyphenyl)methyl]-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]pyrazolo[4,3-d]pyrimidin-7-amine (PubChem CID 172523054) has the molecular formula C35H41BrN8O3Si and a molecular weight of 729.76 g/mol. Its IUPAC name is 5-azido-2-[(4-bromo-2,6-dimethoxyphenyl)methyl]-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]pyrazolo[4,3-d]pyrimidin-7-amine.
| Compound Name | 5-azido-2-[(4-bromo-2,6-dimethoxyphenyl)methyl]-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]pyrazolo[4,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 172523054 |
| Molecular Formula | C35H41BrN8O3Si |
| Molecular Weight | 729.76 g/mol |
| Exact Mass | 728.23 |
| IUPAC Name | 5-azido-2-[(4-bromo-2,6-dimethoxyphenyl)methyl]-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]pyrazolo[4,3-d]pyrimidin-7-amine |
| SMILES | CCC[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Nc1nc(N=[N+]=[N-])nc2cn(Cc3c(OC)cc(Br)cc3OC)nc12 |
| InChI | InChI=1S/C35H41BrN8O3Si/c1-7-14-25(23-47-48(35(2,3)4,26-15-10-8-11-16-26)27-17-12-9-13-18-27)38-33-32-29(39-34(40-33)41-43-37)22-44(42-32)21-28-30(45-5)19-24(36)20-31(28)46-6/h8-13,15-20,22,25H,7,14,21,23H2,1-6H3,(H,38,39,40)/t25-/m0/s1 |
| InChIKey | XOEHOOYEKBOKBI-VWLOTQADSA-N |
| XLogP | 7.75 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.76 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|