C25H19N — CID 172524274
1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole (PubChem CID 172524274) has the molecular formula C25H19N and a molecular weight of 349.53 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole |
|---|---|
| PubChem CID | 172524274 |
| Molecular Formula | C25H19N |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-6-(2,3,4,5,6-pentadeuteriophenyl)-9-(2,3,4,6-tetradeuterio-5-methylphenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c3c(c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2n3-c2c([2H])c([2H])c([2H])c(C)c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C25H19N/c1-18-8-7-11-21(16-18)26-24-13-6-5-12-22(24)23-17-20(14-15-25(23)26)19-9-3-2-4-10-19/h2-17H,1H3/i2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D |
| InChIKey | USKBPCKFDHLXQC-YMFOHVQMSA-N |
| XLogP | 6.76 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |