C42H27NO — CID 172524297
9-(3-dibenzofuran-2-ylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole (PubChem CID 172524297) has the molecular formula C42H27NO and a molecular weight of 571.75 g/mol. Its IUPAC name is 9-(3-dibenzofuran-2-ylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole.
| Compound Name | 9-(3-dibenzofuran-2-ylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole |
|---|---|
| PubChem CID | 172524297 |
| Molecular Formula | C42H27NO |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 9-(3-dibenzofuran-2-ylphenyl)-3,6-bis(2,3,4,5,6-pentadeuteriophenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(c2)c2cc(-c4c([2H])c([2H])c([2H])c([2H])c4[2H])ccc2n3-c2cccc(-c3ccc4oc5ccccc5c4c3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C42H27NO/c1-3-10-28(11-4-1)31-18-21-39-36(25-31)37-26-32(29-12-5-2-6-13-29)19-22-40(37)43(39)34-15-9-14-30(24-34)33-20-23-42-38(27-33)35-16-7-8-17-41(35)44-42/h1-27H/i1D,2D,3D,4D,5D,6D,10D,11D,12D,13D |
| InChIKey | RKKKEDJTAVOPKR-KJIKOLQBSA-N |
| XLogP | 11.68 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |