About 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid
3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid (PubChem CID 172525517) has the molecular formula C18H11F3N4O3
and a molecular weight of 388.31 g/mol. Its IUPAC name is 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid |
| PubChem CID | 172525517 |
| Molecular Formula | C18H11F3N4O3 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid |
| SMILES | Cn1cc2c(n1)c(=O)n(-c1cccc(C(=O)O)c1)c1nc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H11F3N4O3/c1-24-8-12-11-5-6-13(18(19,20)21)22-15(11)25(16(26)14(12)23-24)10-4-2-3-9(7-10)17(27)28/h2-8H,1H3,(H,27,28) |
| InChIKey | SHNNCSRIPGOPGO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid?
The IUPAC name of 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid (CID 172525517) is 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid.
What is the SMILES notation for 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid?
The canonical SMILES for 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid is Cn1cc2c(n1)c(=O)n(-c1cccc(C(=O)O)c1)c1nc(C(F)(F)F)ccc21.
What is the InChIKey of 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid?
The InChIKey is SHNNCSRIPGOPGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F3N4O3/c1-24-8-12-11-5-6-13(18(19,20)21)22-15(11)25(16(26)14(12)23-24)10-4-2-3-9(7-10)17(27)28/h2-8H,1H3,(H,27,28).
What are the key properties of 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid?
3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid has a molecular weight of 388.31 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-methyl-4-oxo-7-(trifluoromethyl)pyrazolo[3,4-c][1,8]naphthyridin-5-yl]benzoic acid is sourced from PubChem (CID 172525517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).