C13H8N2O — CID 172525597
(2E)-2-isocyano-2-(6-methyl-3-oxoinden-1-ylidene)acetonitrile (PubChem CID 172525597) has the molecular formula C13H8N2O and a molecular weight of 208.22 g/mol. Its IUPAC name is (2E)-2-isocyano-2-(6-methyl-3-oxoinden-1-ylidene)acetonitrile.
| Compound Name | (2E)-2-isocyano-2-(6-methyl-3-oxoinden-1-ylidene)acetonitrile |
|---|---|
| PubChem CID | 172525597 |
| Molecular Formula | C13H8N2O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2E)-2-isocyano-2-(6-methyl-3-oxoinden-1-ylidene)acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1\CC(=O)c2ccc(C)cc21 |
| InChI | InChI=1S/C13H8N2O/c1-8-3-4-9-10(5-8)11(6-13(9)16)12(7-14)15-2/h3-5H,6H2,1H3/b12-11+ |
| InChIKey | ULOWKXJCIBXLDA-VAWYXSNFSA-N |
| XLogP | 2.74 |
| TPSA | 45.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|