C45H30N4S — CID 172525966
1,3,4,5,6,8-hexadeuterio-9-[2,5-dideuterio-3-dibenzothiophen-4-yl-6-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 172525966) has the molecular formula C45H30N4S and a molecular weight of 666.88 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexadeuterio-9-[2,5-dideuterio-3-dibenzothiophen-4-yl-6-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 1,3,4,5,6,8-hexadeuterio-9-[2,5-dideuterio-3-dibenzothiophen-4-yl-6-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 172525966 |
| Molecular Formula | C45H30N4S |
| Molecular Weight | 666.88 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | 1,3,4,5,6,8-hexadeuterio-9-[2,5-dideuterio-3-dibenzothiophen-4-yl-6-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | [2H]c1cc(-c2cccc3c2sc2ccccc23)c([2H])c(-n2c3c([2H])cc([2H])c([2H])c3c3c([2H])c([2H])cc([2H])c32)c1C1=NC(c2ccccc2)N=C(c2ccccc2)N1 |
| InChI | InChI=1S/C45H30N4S/c1-3-14-29(15-4-1)43-46-44(30-16-5-2-6-17-30)48-45(47-43)37-27-26-31(32-21-13-22-36-35-20-9-12-25-41(35)50-42(32)36)28-40(37)49-38-23-10-7-18-33(38)34-19-8-11-24-39(34)49/h1-28,43H,(H,46,47,48)/i7D,8D,18D,19D,23D,24D,27D,28D |
| InChIKey | OMINOWDUEAKFOI-GRGGQWFRSA-N |
| XLogP | 11.31 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.88 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |