C60H41N — CID 172527082
2,3,5,6-tetradeuterio-4-(4-naphthalen-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)aniline (PubChem CID 172527082) has the molecular formula C60H41N and a molecular weight of 784.04 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(4-naphthalen-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)aniline.
| Compound Name | 2,3,5,6-tetradeuterio-4-(4-naphthalen-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)aniline |
|---|---|
| PubChem CID | 172527082 |
| Molecular Formula | C60H41N |
| Molecular Weight | 784.04 g/mol |
| Exact Mass | 783.37 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(4-naphthalen-2-ylphenyl)-N-[4-(2-phenylnaphthalen-1-yl)phenyl]-N-(2,3,5,6-tetradeuterio-4-naphthalen-2-ylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2ccc(-c3c(-c4ccccc4)ccc4ccccc34)cc2)c2c([2H])c([2H])c(-c3ccc4ccccc4c3)c([2H])c2[2H])c([2H])c([2H])c1-c1ccc(-c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C60H41N/c1-2-12-48(13-3-1)59-39-32-49-14-8-9-17-58(49)60(59)50-30-37-57(38-31-50)61(56-35-28-47(29-36-56)54-25-23-43-11-5-7-16-52(43)41-54)55-33-26-45(27-34-55)44-18-20-46(21-19-44)53-24-22-42-10-4-6-15-51(42)40-53/h1-41H/i26D,27D,28D,29D,33D,34D,35D,36D |
| InChIKey | IKLYWJOYHDKYCH-WDIXSFBVSA-N |
| XLogP | 16.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.04 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |