About 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide
5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide (PubChem CID 17253008) has the molecular formula C16H19N3O4
and a molecular weight of 317.34 g/mol. Its IUPAC name is 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 17253008 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1cc(-c2cccc(O)c2)on1 |
| InChI | InChI=1S/C16H19N3O4/c20-13-3-1-2-12(10-13)15-11-14(18-23-15)16(21)17-4-5-19-6-8-22-9-7-19/h1-3,10-11,20H,4-9H2,(H,17,21) |
| InChIKey | DLASRZPKKYTHKY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide (CID 17253008) is 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide is O=C(NCCN1CCOCC1)c1cc(-c2cccc(O)c2)on1.
What is the InChIKey of 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is DLASRZPKKYTHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c20-13-3-1-2-12(10-13)15-11-14(18-23-15)16(21)17-4-5-19-6-8-22-9-7-19/h1-3,10-11,20H,4-9H2,(H,17,21).
What are the key properties of 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide?
5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 317.34 g/mol, XLogP of 1.11, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-hydroxyphenyl)-N-(2-morpholin-4-ylethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 17253008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).