C60H55F2N4O+ — CID 172531616
2-[3-tert-butyl-5-[3-[4-tert-butyl-2,6-bis(4-fluorophenyl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 172531616) has the molecular formula C60H55F2N4O+ and a molecular weight of 886.12 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[3-[4-tert-butyl-2,6-bis(4-fluorophenyl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-[3-[4-tert-butyl-2,6-bis(4-fluorophenyl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 172531616 |
| Molecular Formula | C60H55F2N4O+ |
| Molecular Weight | 886.12 g/mol |
| Exact Mass | 885.43 |
| IUPAC Name | 2-[3-tert-butyl-5-[3-[4-tert-butyl-2,6-bis(4-fluorophenyl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)(C)c1cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc(-n2c[n+](-c3c(-c4ccc(F)cc4)cc(C(C)(C)C)cc3-c3ccc(F)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C60H55F2N4O/c1-58(2,3)40-28-29-63-56(34-40)66-52-15-11-10-14-48(52)49-27-26-46(36-55(49)66)67-47-31-41(59(4,5)6)30-45(35-47)64-37-65(54-17-13-12-16-53(54)64)57-50(38-18-22-43(61)23-19-38)32-42(60(7,8)9)33-51(57)39-20-24-44(62)25-21-39/h10-37H,1-9H3/q+1 |
| InChIKey | LMTYDDUHFRUKDQ-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.12 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|