C30H33FN6O2 — CID 172532262
2-fluoro-4-[[4-(3-methoxypropyl)pyrimidin-2-yl]amino]-N-(8-methylisoquinolin-1-yl)-N-[(3R)-piperidin-3-yl]benzamide (PubChem CID 172532262) has the molecular formula C30H33FN6O2 and a molecular weight of 528.63 g/mol. Its IUPAC name is 2-fluoro-4-[[4-(3-methoxypropyl)pyrimidin-2-yl]amino]-N-(8-methylisoquinolin-1-yl)-N-[(3R)-piperidin-3-yl]benzamide.
| Compound Name | 2-fluoro-4-[[4-(3-methoxypropyl)pyrimidin-2-yl]amino]-N-(8-methylisoquinolin-1-yl)-N-[(3R)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 172532262 |
| Molecular Formula | C30H33FN6O2 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-fluoro-4-[[4-(3-methoxypropyl)pyrimidin-2-yl]amino]-N-(8-methylisoquinolin-1-yl)-N-[(3R)-piperidin-3-yl]benzamide |
| SMILES | COCCCc1ccnc(Nc2ccc(C(=O)N(c3nccc4cccc(C)c34)[C@@H]3CCCNC3)c(F)c2)n1 |
| InChI | InChI=1S/C30H33FN6O2/c1-20-6-3-7-21-12-15-33-28(27(20)21)37(24-9-4-14-32-19-24)29(38)25-11-10-23(18-26(25)31)36-30-34-16-13-22(35-30)8-5-17-39-2/h3,6-7,10-13,15-16,18,24,32H,4-5,8-9,14,17,19H2,1-2H3,(H,34,35,36)/t24-/m1/s1 |
| InChIKey | WSEMURIMUYWGCE-XMMPIXPASA-N |
| XLogP | 5.19 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|