C27H30IN3O3 — CID 172532357
tert-butyl (3R)-3-[(4-iodobenzoyl)-(8-methylisoquinolin-1-yl)amino]piperidine-1-carboxylate (PubChem CID 172532357) has the molecular formula C27H30IN3O3 and a molecular weight of 571.46 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-iodobenzoyl)-(8-methylisoquinolin-1-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(4-iodobenzoyl)-(8-methylisoquinolin-1-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 172532357 |
| Molecular Formula | C27H30IN3O3 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | tert-butyl (3R)-3-[(4-iodobenzoyl)-(8-methylisoquinolin-1-yl)amino]piperidine-1-carboxylate |
| SMILES | Cc1cccc2ccnc(N(C(=O)c3ccc(I)cc3)[C@@H]3CCCN(C(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C27H30IN3O3/c1-18-7-5-8-19-14-15-29-24(23(18)19)31(25(32)20-10-12-21(28)13-11-20)22-9-6-16-30(17-22)26(33)34-27(2,3)4/h5,7-8,10-15,22H,6,9,16-17H2,1-4H3/t22-/m1/s1 |
| InChIKey | MRTVGHQCESHXHU-JOCHJYFZSA-N |
| XLogP | 6.19 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|