About methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate
methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate (PubChem CID 172532906) has the molecular formula C13H8ClFN4O2
and a molecular weight of 306.68 g/mol. Its IUPAC name is methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate |
| PubChem CID | 172532906 |
| Molecular Formula | C13H8ClFN4O2 |
| Molecular Weight | 306.68 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(-n2nnc3ccc(Cl)nc32)cc1F |
| InChI | InChI=1S/C13H8ClFN4O2/c1-21-13(20)8-3-2-7(6-9(8)15)19-12-10(17-18-19)4-5-11(14)16-12/h2-6H,1H3 |
| InChIKey | BVTUSUMBLIKRMB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.68 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate?
The IUPAC name of methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate (CID 172532906) is methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate.
What is the SMILES notation for methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate?
The canonical SMILES for methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate is COC(=O)c1ccc(-n2nnc3ccc(Cl)nc32)cc1F.
What is the InChIKey of methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate?
The InChIKey is BVTUSUMBLIKRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClFN4O2/c1-21-13(20)8-3-2-7(6-9(8)15)19-12-10(17-18-19)4-5-11(14)16-12/h2-6H,1H3.
What are the key properties of methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate?
methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate has a molecular weight of 306.68 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(5-chlorotriazolo[4,5-b]pyridin-3-yl)-2-fluorobenzoate is sourced from PubChem (CID 172532906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).