C25H25FN6O — CID 172533403
N-(5-fluoro-8-methylisoquinolin-1-yl)-4-(1-methyltriazol-4-yl)-N-piperidin-3-ylbenzamide (PubChem CID 172533403) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is N-(5-fluoro-8-methylisoquinolin-1-yl)-4-(1-methyltriazol-4-yl)-N-piperidin-3-ylbenzamide.
| Compound Name | N-(5-fluoro-8-methylisoquinolin-1-yl)-4-(1-methyltriazol-4-yl)-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 172533403 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-(5-fluoro-8-methylisoquinolin-1-yl)-4-(1-methyltriazol-4-yl)-N-piperidin-3-ylbenzamide |
| SMILES | Cc1ccc(F)c2ccnc(N(C(=O)c3ccc(-c4cn(C)nn4)cc3)C3CCCNC3)c12 |
| InChI | InChI=1S/C25H25FN6O/c1-16-5-10-21(26)20-11-13-28-24(23(16)20)32(19-4-3-12-27-14-19)25(33)18-8-6-17(7-9-18)22-15-31(2)30-29-22/h5-11,13,15,19,27H,3-4,12,14H2,1-2H3 |
| InChIKey | NKCGAYGDHIOIFR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |