C56H56FN4O+ — CID 172533775
2-[3-tert-butyl-5-[3-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 172533775) has the molecular formula C56H56FN4O+ and a molecular weight of 820.09 g/mol. Its IUPAC name is 2-[3-tert-butyl-5-[3-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-tert-butyl-5-[3-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 172533775 |
| Molecular Formula | C56H56FN4O+ |
| Molecular Weight | 820.09 g/mol |
| Exact Mass | 819.44 |
| IUPAC Name | 2-[3-tert-butyl-5-[3-[4-(4-fluorophenyl)-2,6-di(propan-2-yl)phenyl]benzimidazol-3-ium-1-yl]phenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | CC(C)c1cc(-c2ccc(F)cc2)cc(C(C)C)c1-[n+]1cn(-c2cc(Oc3ccc4c5ccccc5n(-c5cc(C(C)(C)C)ccn5)c4c3)cc(C(C)(C)C)c2)c2ccccc21 |
| InChI | InChI=1S/C56H56FN4O/c1-35(2)47-27-38(37-19-21-41(57)22-20-37)28-48(36(3)4)54(47)60-34-59(50-17-13-14-18-51(50)60)42-29-40(56(8,9)10)30-44(32-42)62-43-23-24-46-45-15-11-12-16-49(45)61(52(46)33-43)53-31-39(25-26-58-53)55(5,6)7/h11-36H,1-10H3/q+1 |
| InChIKey | AGPKGDMAACKALQ-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.09 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|