About 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide
4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide (PubChem CID 172535557) has the molecular formula C15H20FN3O2
and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide.
Molecular Properties
| Compound Name | 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide |
| PubChem CID | 172535557 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide |
| SMILES | [C-]#[N+]COc1cc(C(=O)NC)c(F)cc1NCC(C)(C)C |
| InChI | InChI=1S/C15H20FN3O2/c1-15(2,3)8-19-12-7-11(16)10(14(20)18-5)6-13(12)21-9-17-4/h6-7,19H,8-9H2,1-3,5H3,(H,18,20) |
| InChIKey | MVIIXRZYINACDJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide?
The IUPAC name of 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide (CID 172535557) is 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide.
What is the SMILES notation for 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide?
The canonical SMILES for 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide is [C-]#[N+]COc1cc(C(=O)NC)c(F)cc1NCC(C)(C)C.
What is the InChIKey of 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide?
The InChIKey is MVIIXRZYINACDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FN3O2/c1-15(2,3)8-19-12-7-11(16)10(14(20)18-5)6-13(12)21-9-17-4/h6-7,19H,8-9H2,1-3,5H3,(H,18,20).
What are the key properties of 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide?
4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide has a molecular weight of 293.34 g/mol, XLogP of 2.90, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylpropylamino)-2-fluoro-5-(isocyanomethoxy)-N-methylbenzamide is sourced from PubChem (CID 172535557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).