C23H23F3NO2PS — CID 172535584
2-[4-(4-dimethylphosphoryl-2-methoxyphenyl)but-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine (PubChem CID 172535584) has the molecular formula C23H23F3NO2PS and a molecular weight of 465.48 g/mol. Its IUPAC name is 2-[4-(4-dimethylphosphoryl-2-methoxyphenyl)but-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine.
| Compound Name | 2-[4-(4-dimethylphosphoryl-2-methoxyphenyl)but-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 172535584 |
| Molecular Formula | C23H23F3NO2PS |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 2-[4-(4-dimethylphosphoryl-2-methoxyphenyl)but-1-ynyl]-3-(2,2,2-trifluoroethyl)-1-benzothiophen-7-amine |
| SMILES | COc1cc(P(C)(C)=O)ccc1CCC#Cc1sc2c(N)cccc2c1CC(F)(F)F |
| InChI | InChI=1S/C23H23F3NO2PS/c1-29-20-13-16(30(2,3)28)12-11-15(20)7-4-5-10-21-18(14-23(24,25)26)17-8-6-9-19(27)22(17)31-21/h6,8-9,11-13H,4,7,14,27H2,1-3H3 |
| InChIKey | GTKKVVCVLBRRNB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|