C32H52N6O4 — CID 172537064
2,4-ditert-butyl-6-[2-[9-[2-(4-tert-butyl-6-propan-2-yl-1,3,5-triazin-2-yl)ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]ethyl]-1,3,5-triazine (PubChem CID 172537064) has the molecular formula C32H52N6O4 and a molecular weight of 584.81 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[9-[2-(4-tert-butyl-6-propan-2-yl-1,3,5-triazin-2-yl)ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]ethyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[2-[9-[2-(4-tert-butyl-6-propan-2-yl-1,3,5-triazin-2-yl)ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]ethyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 172537064 |
| Molecular Formula | C32H52N6O4 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[9-[2-(4-tert-butyl-6-propan-2-yl-1,3,5-triazin-2-yl)ethyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl]ethyl]-1,3,5-triazine |
| SMILES | CC(C)c1nc(CCC2OCC3(CO2)COC(CCc2nc(C(C)(C)C)nc(C(C)(C)C)n2)OC3)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C32H52N6O4/c1-20(2)25-33-21(34-26(37-25)29(3,4)5)12-14-23-39-16-32(17-40-23)18-41-24(42-19-32)15-13-22-35-27(30(6,7)8)38-28(36-22)31(9,10)11/h20,23-24H,12-19H2,1-11H3 |
| InChIKey | BSHNCHHHHPVFRK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |