C28H18Cl2F2N6O3 — CID 172537774
4-chloro-3-[6-[(3-chloro-4,5-difluorophenyl)methyl]-8-[(1-methyl-1,2,4-triazol-3-yl)methyl]-7,9-dioxo-2,3-dihydrofuro[2,3-f]quinazolin-4-yl]benzonitrile (PubChem CID 172537774) has the molecular formula C28H18Cl2F2N6O3 and a molecular weight of 595.39 g/mol. Its IUPAC name is 4-chloro-3-[6-[(3-chloro-4,5-difluorophenyl)methyl]-8-[(1-methyl-1,2,4-triazol-3-yl)methyl]-7,9-dioxo-2,3-dihydrofuro[2,3-f]quinazolin-4-yl]benzonitrile.
| Compound Name | 4-chloro-3-[6-[(3-chloro-4,5-difluorophenyl)methyl]-8-[(1-methyl-1,2,4-triazol-3-yl)methyl]-7,9-dioxo-2,3-dihydrofuro[2,3-f]quinazolin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 172537774 |
| Molecular Formula | C28H18Cl2F2N6O3 |
| Molecular Weight | 595.39 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | 4-chloro-3-[6-[(3-chloro-4,5-difluorophenyl)methyl]-8-[(1-methyl-1,2,4-triazol-3-yl)methyl]-7,9-dioxo-2,3-dihydrofuro[2,3-f]quinazolin-4-yl]benzonitrile |
| SMILES | Cn1cnc(Cn2c(=O)c3c4c(c(-c5cc(C#N)ccc5Cl)cc3n(Cc3cc(F)c(F)c(Cl)c3)c2=O)CCO4)n1 |
| InChI | InChI=1S/C28H18Cl2F2N6O3/c1-36-13-34-23(35-36)12-38-27(39)24-22(37(28(38)40)11-15-7-20(30)25(32)21(31)8-15)9-17(16-4-5-41-26(16)24)18-6-14(10-33)2-3-19(18)29/h2-3,6-9,13H,4-5,11-12H2,1H3 |
| InChIKey | GJYXPWDZQYIBFC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 107.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|