C15H13F3N2O2 — CID 172538064
1-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydroquinazoline-2,4-dione (PubChem CID 172538064) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.27 g/mol. Its IUPAC name is 1-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydroquinazoline-2,4-dione.
| Compound Name | 1-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydroquinazoline-2,4-dione |
|---|---|
| PubChem CID | 172538064 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-[(3,4,5-trifluorophenyl)methyl]-5,6,7,8-tetrahydroquinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2cc(F)c(F)c(F)c2)c2c1CCCC2 |
| InChI | InChI=1S/C15H13F3N2O2/c16-10-5-8(6-11(17)13(10)18)7-20-12-4-2-1-3-9(12)14(21)19-15(20)22/h5-6H,1-4,7H2,(H,19,21,22) |
| InChIKey | OJXYJYMUYUZRTG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|