C20H18BrN5O2S2 — CID 172538397
4-[[S-(4-bromophenyl)-N-methylsulfonimidoyl]amino]-2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)naphthalen-1-ol (PubChem CID 172538397) has the molecular formula C20H18BrN5O2S2 and a molecular weight of 504.44 g/mol. Its IUPAC name is 4-[[S-(4-bromophenyl)-N-methylsulfonimidoyl]amino]-2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)naphthalen-1-ol.
| Compound Name | 4-[[S-(4-bromophenyl)-N-methylsulfonimidoyl]amino]-2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 172538397 |
| Molecular Formula | C20H18BrN5O2S2 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 503.01 |
| IUPAC Name | 4-[[S-(4-bromophenyl)-N-methylsulfonimidoyl]amino]-2-(1H-1,2,4-triazol-5-ylmethylsulfanyl)naphthalen-1-ol |
| SMILES | CN=S(=O)(Nc1cc(SCc2ncn[nH]2)c(O)c2ccccc12)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H18BrN5O2S2/c1-22-30(28,14-8-6-13(21)7-9-14)26-17-10-18(29-11-19-23-12-24-25-19)20(27)16-5-3-2-4-15(16)17/h2-10,12,27H,11H2,1H3,(H,22,26,28)(H,23,24,25) |
| InChIKey | BBQPWBVWYJAVAU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|