About 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide
2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide (PubChem CID 17253891) has the molecular formula C16H18N2O5
and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide |
| PubChem CID | 17253891 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)COCc1cc(-c2ccc3c(c2)OCO3)on1 |
| InChI | InChI=1S/C16H18N2O5/c1-10(2)17-16(19)8-20-7-12-6-14(23-18-12)11-3-4-13-15(5-11)22-9-21-13/h3-6,10H,7-9H2,1-2H3,(H,17,19) |
| InChIKey | JLOSEZUJJXJIPS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide?
The IUPAC name of 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide (CID 17253891) is 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide is CC(C)NC(=O)COCc1cc(-c2ccc3c(c2)OCO3)on1.
What is the InChIKey of 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide?
The InChIKey is JLOSEZUJJXJIPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5/c1-10(2)17-16(19)8-20-7-12-6-14(23-18-12)11-3-4-13-15(5-11)22-9-21-13/h3-6,10H,7-9H2,1-2H3,(H,17,19).
What are the key properties of 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide?
2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide has a molecular weight of 318.33 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(1,3-benzodioxol-5-yl)-1,2-oxazol-3-yl]methoxy]-N-propan-2-ylacetamide is sourced from PubChem (CID 17253891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).