C53H34N2O3 — CID 172539704
N-[4-(4-nitrophenyl)phenyl]-N-(4-phenylphenyl)spiro[benzo[c]xanthene-7,9'-fluorene]-2'-amine (PubChem CID 172539704) has the molecular formula C53H34N2O3 and a molecular weight of 746.87 g/mol. Its IUPAC name is N-[4-(4-nitrophenyl)phenyl]-N-(4-phenylphenyl)spiro[benzo[c]xanthene-7,9'-fluorene]-2'-amine.
| Compound Name | N-[4-(4-nitrophenyl)phenyl]-N-(4-phenylphenyl)spiro[benzo[c]xanthene-7,9'-fluorene]-2'-amine |
|---|---|
| PubChem CID | 172539704 |
| Molecular Formula | C53H34N2O3 |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 746.26 |
| IUPAC Name | N-[4-(4-nitrophenyl)phenyl]-N-(4-phenylphenyl)spiro[benzo[c]xanthene-7,9'-fluorene]-2'-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)C3(c5ccccc5Oc5c3ccc3ccccc53)c3ccccc3-4)cc2)cc1 |
| InChI | InChI=1S/C53H34N2O3/c56-55(57)42-29-22-38(23-30-42)37-20-27-41(28-21-37)54(40-25-18-36(19-26-40)35-10-2-1-3-11-35)43-31-32-46-45-14-6-7-15-47(45)53(50(46)34-43)48-16-8-9-17-51(48)58-52-44-13-5-4-12-39(44)24-33-49(52)53/h1-34H |
| InChIKey | KYAVMISNMZTQDS-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|