C28H48F2N2O2Si — CID 172541609
[2-[4-[(4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane (PubChem CID 172541609) has the molecular formula C28H48F2N2O2Si and a molecular weight of 510.79 g/mol. Its IUPAC name is [2-[4-[(4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane.
| Compound Name | [2-[4-[(4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 172541609 |
| Molecular Formula | C28H48F2N2O2Si |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | [2-[4-[(4aR,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
| SMILES | Cc1cc(N2CC(C)(C)N[C@@H]3CCCC[C@@H]32)ccc1OC(F)(F)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H48F2N2O2Si/c1-19(2)35(20(3)4,21(5)6)33-18-28(29,30)34-26-15-14-23(16-22(26)7)32-17-27(8,9)31-24-12-10-11-13-25(24)32/h14-16,19-21,24-25,31H,10-13,17-18H2,1-9H3/t24-,25+/m1/s1 |
| InChIKey | MZQHVOFMRKTWCA-RPBOFIJWSA-N |
| XLogP | 7.66 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|