C28H47F3N2O2Si — CID 172541651
[2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-fluoro-6-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane (PubChem CID 172541651) has the molecular formula C28H47F3N2O2Si and a molecular weight of 528.78 g/mol. Its IUPAC name is [2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-fluoro-6-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane.
| Compound Name | [2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-fluoro-6-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 172541651 |
| Molecular Formula | C28H47F3N2O2Si |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | [2-[4-[(4aS,8aS)-3,3-dimethyl-2,4,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-fluoro-6-methylphenoxy]-2,2-difluoroethoxy]-tri(propan-2-yl)silane |
| SMILES | Cc1cc(N2CC(C)(C)N[C@H]3CCCC[C@@H]32)cc(F)c1OC(F)(F)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H47F3N2O2Si/c1-18(2)36(19(3)4,20(5)6)34-17-28(30,31)35-26-21(7)14-22(15-23(26)29)33-16-27(8,9)32-24-12-10-11-13-25(24)33/h14-15,18-20,24-25,32H,10-13,16-17H2,1-9H3/t24-,25-/m0/s1 |
| InChIKey | MUOXJNWSTHOJAY-DQEYMECFSA-N |
| XLogP | 7.80 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|