About 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol
1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol (PubChem CID 172542292) has the molecular formula C12H9ClF3NOS
and a molecular weight of 307.72 g/mol. Its IUPAC name is 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol |
| PubChem CID | 172542292 |
| Molecular Formula | C12H9ClF3NOS |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol |
| SMILES | OC1(c2cc3ccc(Cl)nc3s2)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H9ClF3NOS/c13-9-2-1-6-3-8(19-10(6)17-9)11(18)4-7(5-11)12(14,15)16/h1-3,7,18H,4-5H2 |
| InChIKey | DJJRJMJHKLCXSC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol?
The IUPAC name of 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol (CID 172542292) is 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol.
What is the SMILES notation for 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol?
The canonical SMILES for 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol is OC1(c2cc3ccc(Cl)nc3s2)CC(C(F)(F)F)C1.
What is the InChIKey of 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol?
The InChIKey is DJJRJMJHKLCXSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF3NOS/c13-9-2-1-6-3-8(19-10(6)17-9)11(18)4-7(5-11)12(14,15)16/h1-3,7,18H,4-5H2.
What are the key properties of 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol?
1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol has a molecular weight of 307.72 g/mol, XLogP of 4.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chlorothieno[2,3-b]pyridin-2-yl)-3-(trifluoromethyl)cyclobutan-1-ol is sourced from PubChem (CID 172542292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).