About 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol
1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol (PubChem CID 172542336) has the molecular formula C12H10ClF2NOS
and a molecular weight of 289.73 g/mol. Its IUPAC name is 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol |
| PubChem CID | 172542336 |
| Molecular Formula | C12H10ClF2NOS |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol |
| SMILES | Cc1c(C2(O)CC(F)(F)C2)sc2nc(Cl)ccc12 |
| InChI | InChI=1S/C12H10ClF2NOS/c1-6-7-2-3-8(13)16-10(7)18-9(6)11(17)4-12(14,15)5-11/h2-3,17H,4-5H2,1H3 |
| InChIKey | KPTWTVSIJOQNPA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol?
The IUPAC name of 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol (CID 172542336) is 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol.
What is the SMILES notation for 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol?
The canonical SMILES for 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol is Cc1c(C2(O)CC(F)(F)C2)sc2nc(Cl)ccc12.
What is the InChIKey of 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol?
The InChIKey is KPTWTVSIJOQNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClF2NOS/c1-6-7-2-3-8(13)16-10(7)18-9(6)11(17)4-12(14,15)5-11/h2-3,17H,4-5H2,1H3.
What are the key properties of 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol?
1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol has a molecular weight of 289.73 g/mol, XLogP of 3.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-3-methylthieno[2,3-b]pyridin-2-yl)-3,3-difluorocyclobutan-1-ol is sourced from PubChem (CID 172542336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).