About (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol
(6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol (PubChem CID 172542463) has the molecular formula C13H14ClNO2S
and a molecular weight of 283.78 g/mol. Its IUPAC name is (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol.
Molecular Properties
| Compound Name | (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol |
| PubChem CID | 172542463 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol |
| SMILES | OC(c1cc2ccc(Cl)nc2s1)C1CCOCC1 |
| InChI | InChI=1S/C13H14ClNO2S/c14-11-2-1-9-7-10(18-13(9)15-11)12(16)8-3-5-17-6-4-8/h1-2,7-8,12,16H,3-6H2 |
| InChIKey | MGJAEEOQABKOPQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol?
The IUPAC name of (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol (CID 172542463) is (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol.
What is the SMILES notation for (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol?
The canonical SMILES for (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol is OC(c1cc2ccc(Cl)nc2s1)C1CCOCC1.
What is the InChIKey of (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol?
The InChIKey is MGJAEEOQABKOPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClNO2S/c14-11-2-1-9-7-10(18-13(9)15-11)12(16)8-3-5-17-6-4-8/h1-2,7-8,12,16H,3-6H2.
What are the key properties of (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol?
(6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol has a molecular weight of 283.78 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chlorothieno[2,3-b]pyridin-2-yl)-(oxan-4-yl)methanol is sourced from PubChem (CID 172542463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).