About (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol
(S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol (PubChem CID 172542490) has the molecular formula C16H14F2N4OS
and a molecular weight of 348.38 g/mol. Its IUPAC name is (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol.
Molecular Properties
| Compound Name | (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol |
| PubChem CID | 172542490 |
| Molecular Formula | C16H14F2N4OS |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol |
| SMILES | Nc1c([C@@H](O)C2CC(F)(F)C2)sc2nc(-c3cncnc3)ccc12 |
| InChI | InChI=1S/C16H14F2N4OS/c17-16(18)3-8(4-16)13(23)14-12(19)10-1-2-11(22-15(10)24-14)9-5-20-7-21-6-9/h1-2,5-8,13,23H,3-4,19H2/t13-/m0/s1 |
| InChIKey | NECGASGQTIGFJA-ZDUSSCGKSA-N |
| XLogP | 3.41 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol?
The IUPAC name of (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol (CID 172542490) is (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol.
What is the SMILES notation for (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol?
The canonical SMILES for (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol is Nc1c([C@@H](O)C2CC(F)(F)C2)sc2nc(-c3cncnc3)ccc12.
What is the InChIKey of (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol?
The InChIKey is NECGASGQTIGFJA-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H14F2N4OS/c17-16(18)3-8(4-16)13(23)14-12(19)10-1-2-11(22-15(10)24-14)9-5-20-7-21-6-9/h1-2,5-8,13,23H,3-4,19H2/t13-/m0/s1.
What are the key properties of (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol?
(S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol has a molecular weight of 348.38 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(3-amino-6-pyrimidin-5-ylthieno[2,3-b]pyridin-2-yl)-(3,3-difluorocyclobutyl)methanol is sourced from PubChem (CID 172542490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).