About 1,6-diaminopentalene-2,5-dicarbonitrile
1,6-diaminopentalene-2,5-dicarbonitrile (PubChem CID 172543726) has the molecular formula C10H6N4
and a molecular weight of 182.19 g/mol. Its IUPAC name is 1,6-diaminopentalene-2,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1,6-diaminopentalene-2,5-dicarbonitrile |
| PubChem CID | 172543726 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 1,6-diaminopentalene-2,5-dicarbonitrile |
| SMILES | N#CC1=CC2=CC(C#N)=C(N)C2=C1N |
| InChI | InChI=1S/C10H6N4/c11-3-6-1-5-2-7(4-12)10(14)8(5)9(6)13/h1-2H,13-14H2 |
| InChIKey | RQJITJDXFMYDRF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,6-diaminopentalene-2,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diaminopentalene-2,5-dicarbonitrile?
The IUPAC name of 1,6-diaminopentalene-2,5-dicarbonitrile (CID 172543726) is 1,6-diaminopentalene-2,5-dicarbonitrile.
What is the SMILES notation for 1,6-diaminopentalene-2,5-dicarbonitrile?
The canonical SMILES for 1,6-diaminopentalene-2,5-dicarbonitrile is N#CC1=CC2=CC(C#N)=C(N)C2=C1N.
What is the InChIKey of 1,6-diaminopentalene-2,5-dicarbonitrile?
The InChIKey is RQJITJDXFMYDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4/c11-3-6-1-5-2-7(4-12)10(14)8(5)9(6)13/h1-2H,13-14H2.
What are the key properties of 1,6-diaminopentalene-2,5-dicarbonitrile?
1,6-diaminopentalene-2,5-dicarbonitrile has a molecular weight of 182.19 g/mol, XLogP of 0.34, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diaminopentalene-2,5-dicarbonitrile is sourced from PubChem (CID 172543726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).