C13H9N3 — CID 172543879
4,8-diamino-s-indacene-2-carbonitrile (PubChem CID 172543879) has the molecular formula C13H9N3 and a molecular weight of 207.24 g/mol. Its IUPAC name is 4,8-diamino-s-indacene-2-carbonitrile.
| Compound Name | 4,8-diamino-s-indacene-2-carbonitrile |
|---|---|
| PubChem CID | 172543879 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4,8-diamino-s-indacene-2-carbonitrile |
| SMILES | N#CC1=Cc2c(N)c3c(c(N)c2=C1)C=CC=3 |
| InChI | InChI=1S/C13H9N3/c14-6-7-4-10-11(5-7)13(16)9-3-1-2-8(9)12(10)15/h1-5H,15-16H2 |
| InChIKey | TVJCIJNORXZXRZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|