C10H9N5 — CID 172543935
10-imino-3,7-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,11-pentaene-8,12-diamine (PubChem CID 172543935) has the molecular formula C10H9N5 and a molecular weight of 199.22 g/mol. Its IUPAC name is 10-imino-3,7-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,11-pentaene-8,12-diamine.
| Compound Name | 10-imino-3,7-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,11-pentaene-8,12-diamine |
|---|---|
| PubChem CID | 172543935 |
| Molecular Formula | C10H9N5 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 10-imino-3,7-diazatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,7,11-pentaene-8,12-diamine |
| SMILES | [H]/N=C1\C=C(N)c2c1c(N)nc1cc[nH]c21 |
| InChI | InChI=1S/C10H9N5/c11-4-3-5(12)8-7(4)9-6(1-2-14-9)15-10(8)13/h1-3,12,14H,11H2,(H2,13,15)/b12-5+ |
| InChIKey | DVUJYHHAMCHIAS-LFYBBSHMSA-N |
| XLogP | 0.83 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|