C12H11N5 — CID 172544238
4,6-diazatricyclo[7.5.0.02,8]tetradeca-1(14),2,4,6,8,10,12-heptaene-3,5,7-triamine (PubChem CID 172544238) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4,6-diazatricyclo[7.5.0.02,8]tetradeca-1(14),2,4,6,8,10,12-heptaene-3,5,7-triamine.
| Compound Name | 4,6-diazatricyclo[7.5.0.02,8]tetradeca-1(14),2,4,6,8,10,12-heptaene-3,5,7-triamine |
|---|---|
| PubChem CID | 172544238 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4,6-diazatricyclo[7.5.0.02,8]tetradeca-1(14),2,4,6,8,10,12-heptaene-3,5,7-triamine |
| SMILES | Nc1nc(N)c2c3cccccc-3c-2c(N)n1 |
| InChI | InChI=1S/C12H11N5/c13-10-8-6-4-2-1-3-5-7(6)9(8)11(14)17-12(15)16-10/h1-5H,(H6,13,14,15,16,17) |
| InChIKey | WTGUYRUGOVWXDU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |