C15H8N4 — CID 172544272
5-amino-4-azatricyclo[7.5.0.02,8]tetradeca-1,3,5,7,9,11,13-heptaene-6,14-dicarbonitrile (PubChem CID 172544272) has the molecular formula C15H8N4 and a molecular weight of 244.26 g/mol. Its IUPAC name is 5-amino-4-azatricyclo[7.5.0.02,8]tetradeca-1,3,5,7,9,11,13-heptaene-6,14-dicarbonitrile.
| Compound Name | 5-amino-4-azatricyclo[7.5.0.02,8]tetradeca-1,3,5,7,9,11,13-heptaene-6,14-dicarbonitrile |
|---|---|
| PubChem CID | 172544272 |
| Molecular Formula | C15H8N4 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-amino-4-azatricyclo[7.5.0.02,8]tetradeca-1,3,5,7,9,11,13-heptaene-6,14-dicarbonitrile |
| SMILES | N#Cc1cc2c3ccccc(C#N)c-3c-2cnc1N |
| InChI | InChI=1S/C15H8N4/c16-6-9-3-1-2-4-11-12-5-10(7-17)15(18)19-8-13(12)14(9)11/h1-5,8H,(H2,18,19) |
| InChIKey | JYCYXNFDJXIDQK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |