C13H4N8 — CID 172544513
11-amino-2,4,6,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene-8,12,14-tricarbonitrile (PubChem CID 172544513) has the molecular formula C13H4N8 and a molecular weight of 272.23 g/mol. Its IUPAC name is 11-amino-2,4,6,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene-8,12,14-tricarbonitrile.
| Compound Name | 11-amino-2,4,6,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene-8,12,14-tricarbonitrile |
|---|---|
| PubChem CID | 172544513 |
| Molecular Formula | C13H4N8 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 11-amino-2,4,6,10-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,7,9,11,13-heptaene-8,12,14-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c2nc3ncnc3c(C#N)c2nc1N |
| InChI | InChI=1S/C13H4N8/c14-2-6-1-7(3-15)12(17)20-10-8(4-16)11-13(19-5-18-11)21-9(6)10/h1,5H,(H2,17,20) |
| InChIKey | QBQTUQISKSTJOX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |