C43H51F3IrNO2S- — CID 172545433
1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxy-7-methylnon-5-en-4-one;iridium (PubChem CID 172545433) has the molecular formula C43H51F3IrNO2S- and a molecular weight of 895.16 g/mol. Its IUPAC name is 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxy-7-methylnon-5-en-4-one;iridium.
| Compound Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxy-7-methylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 172545433 |
| Molecular Formula | C43H51F3IrNO2S- |
| Molecular Weight | 895.16 g/mol |
| Exact Mass | 895.32 |
| IUPAC Name | 1-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-8-(2-methylpropyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-1,1,1-trifluoro-6-hydroxy-7-methylnon-5-en-4-one;iridium |
| SMILES | CC(C)Cc1cccc2c1sc1c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)nccc12.CCC(CC(F)(F)F)C(=O)/C=C(\O)C(C)(CC)CC.[Ir] |
| InChI | InChI=1S/C29H28NS.C14H23F3O2.Ir/c1-18(2)15-20-10-8-12-23-24-13-14-30-26(28(24)31-27(20)23)21-16-19-9-6-7-11-22(19)25(17-21)29(3,4)5;1-5-10(9-14(15,16)17)11(18)8-12(19)13(4,6-2)7-3;/h6-14,17-18H,15H2,1-5H3;8,10,19H,5-7,9H2,1-4H3;/q-1;;/b;12-8-; |
| InChIKey | KXUJEYPYEYXXPB-HNTNAPOYSA-N |
| XLogP | 13.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.16 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|