C14H28N4O4 — CID 172546743
tert-butyl N-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]diaziridin-3-yl]methyl]carbamate (PubChem CID 172546743) has the molecular formula C14H28N4O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl N-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]diaziridin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]diaziridin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 172546743 |
| Molecular Formula | C14H28N4O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | tert-butyl N-[[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]diaziridin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1(CNC(=O)OC(C)(C)C)NN1 |
| InChI | InChI=1S/C14H28N4O4/c1-12(2,3)21-10(19)15-8-7-14(17-18-14)9-16-11(20)22-13(4,5)6/h17-18H,7-9H2,1-6H3,(H,15,19)(H,16,20) |
| InChIKey | RZRSDFDWLBXWOP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|