C7H13O6PS — CID 172548142
4-[(5-methyl-1,3,2-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide (PubChem CID 172548142) has the molecular formula C7H13O6PS and a molecular weight of 256.22 g/mol. Its IUPAC name is 4-[(5-methyl-1,3,2-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide.
| Compound Name | 4-[(5-methyl-1,3,2-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 172548142 |
| Molecular Formula | C7H13O6PS |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4-[(5-methyl-1,3,2-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
| SMILES | CC1COP(OC2COS(=O)(=O)C2)OC1 |
| InChI | InChI=1S/C7H13O6PS/c1-6-2-10-14(11-3-6)13-7-4-12-15(8,9)5-7/h6-7H,2-5H2,1H3 |
| InChIKey | JGWAKLAFDFGJIN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|