C6H11O7PS — CID 172548152
4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide (PubChem CID 172548152) has the molecular formula C6H11O7PS and a molecular weight of 258.19 g/mol. Its IUPAC name is 4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide.
| Compound Name | 4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 172548152 |
| Molecular Formula | C6H11O7PS |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | 4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
| SMILES | O=P1(OC2COS(=O)(=O)C2)OCCCO1 |
| InChI | InChI=1S/C6H11O7PS/c7-14(10-2-1-3-11-14)13-6-4-12-15(8,9)5-6/h6H,1-5H2 |
| InChIKey | ZQBRBRRDONXHOD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|