C6H10FO7PS — CID 172548162
4-[(4-fluoro-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide (PubChem CID 172548162) has the molecular formula C6H10FO7PS and a molecular weight of 276.18 g/mol. Its IUPAC name is 4-[(4-fluoro-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide.
| Compound Name | 4-[(4-fluoro-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 172548162 |
| Molecular Formula | C6H10FO7PS |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 4-[(4-fluoro-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
| SMILES | O=P1(OC2COS(=O)(=O)C2)OCCC(F)O1 |
| InChI | InChI=1S/C6H10FO7PS/c7-6-1-2-11-15(8,14-6)13-5-3-12-16(9,10)4-5/h5-6H,1-4H2 |
| InChIKey | GXZYKDQWJSZAMH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|