About 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide
4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide (PubChem CID 172548164) has the molecular formula C6H11O6PS
and a molecular weight of 242.19 g/mol. Its IUPAC name is 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide.
Molecular Properties
| Compound Name | 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide |
| PubChem CID | 172548164 |
| Molecular Formula | C6H11O6PS |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide |
| SMILES | O=S1(=O)CC(OP2OCCCO2)CO1 |
| InChI | InChI=1S/C6H11O6PS/c7-14(8)5-6(4-11-14)12-13-9-2-1-3-10-13/h6H,1-5H2 |
| InChIKey | KHKHVZDQMPLOSC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide?
The IUPAC name of 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide (CID 172548164) is 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide.
What is the SMILES notation for 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide?
The canonical SMILES for 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide is O=S1(=O)CC(OP2OCCCO2)CO1.
What is the InChIKey of 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide?
The InChIKey is KHKHVZDQMPLOSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O6PS/c7-14(8)5-6(4-11-14)12-13-9-2-1-3-10-13/h6H,1-5H2.
What are the key properties of 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide?
4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide has a molecular weight of 242.19 g/mol, XLogP of 0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,2-dioxaphosphinan-2-yloxy)oxathiolane 2,2-dioxide is sourced from PubChem (CID 172548164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).