C7H13O7PS — CID 172548167
4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide (PubChem CID 172548167) has the molecular formula C7H13O7PS and a molecular weight of 272.21 g/mol. Its IUPAC name is 4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide.
| Compound Name | 4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 172548167 |
| Molecular Formula | C7H13O7PS |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]oxathiolane 2,2-dioxide |
| SMILES | CC1COP(=O)(OC2COS(=O)(=O)C2)OC1 |
| InChI | InChI=1S/C7H13O7PS/c1-6-2-11-15(8,12-3-6)14-7-4-13-16(9,10)5-7/h6-7H,2-5H2,1H3 |
| InChIKey | GAARZKLAYCZBIW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|