C28H32F4N2 — CID 172550292
4-[2-(4-amino-3-cyclobutyl-5-cyclopropylphenyl)-1,1,2,2-tetrafluoroethyl]-2-cyclobutyl-6-cyclopropylaniline (PubChem CID 172550292) has the molecular formula C28H32F4N2 and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-[2-(4-amino-3-cyclobutyl-5-cyclopropylphenyl)-1,1,2,2-tetrafluoroethyl]-2-cyclobutyl-6-cyclopropylaniline.
| Compound Name | 4-[2-(4-amino-3-cyclobutyl-5-cyclopropylphenyl)-1,1,2,2-tetrafluoroethyl]-2-cyclobutyl-6-cyclopropylaniline |
|---|---|
| PubChem CID | 172550292 |
| Molecular Formula | C28H32F4N2 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 4-[2-(4-amino-3-cyclobutyl-5-cyclopropylphenyl)-1,1,2,2-tetrafluoroethyl]-2-cyclobutyl-6-cyclopropylaniline |
| SMILES | Nc1c(C2CCC2)cc(C(F)(F)C(F)(F)c2cc(C3CCC3)c(N)c(C3CC3)c2)cc1C1CC1 |
| InChI | InChI=1S/C28H32F4N2/c29-27(30,19-11-21(15-3-1-4-15)25(33)23(13-19)17-7-8-17)28(31,32)20-12-22(16-5-2-6-16)26(34)24(14-20)18-9-10-18/h11-18H,1-10,33-34H2 |
| InChIKey | YJOACEYQOGEJKC-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|