C32H32F20N2 — CID 172550333
4-[10-(4-amino-3-butan-2-yl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluorodecyl]-2-butan-2-yl-6-methylaniline (PubChem CID 172550333) has the molecular formula C32H32F20N2 and a molecular weight of 824.58 g/mol. Its IUPAC name is 4-[10-(4-amino-3-butan-2-yl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluorodecyl]-2-butan-2-yl-6-methylaniline.
| Compound Name | 4-[10-(4-amino-3-butan-2-yl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluorodecyl]-2-butan-2-yl-6-methylaniline |
|---|---|
| PubChem CID | 172550333 |
| Molecular Formula | C32H32F20N2 |
| Molecular Weight | 824.58 g/mol |
| Exact Mass | 824.22 |
| IUPAC Name | 4-[10-(4-amino-3-butan-2-yl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-icosafluorodecyl]-2-butan-2-yl-6-methylaniline |
| SMILES | CCC(C)c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2cc(C)c(N)c(C(C)CC)c2)cc(C)c1N |
| InChI | InChI=1S/C32H32F20N2/c1-7-13(3)19-11-17(9-15(5)21(19)53)23(33,34)25(37,38)27(41,42)29(45,46)31(49,50)32(51,52)30(47,48)28(43,44)26(39,40)24(35,36)18-10-16(6)22(54)20(12-18)14(4)8-2/h9-14H,7-8,53-54H2,1-6H3 |
| InChIKey | AVOABJFWNMZDSA-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.58 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|