C32H44F8N2 — CID 172550400
4-[4-[4-amino-3,5-di(butan-2-yl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutyl]-2,6-di(butan-2-yl)aniline (PubChem CID 172550400) has the molecular formula C32H44F8N2 and a molecular weight of 608.70 g/mol. Its IUPAC name is 4-[4-[4-amino-3,5-di(butan-2-yl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutyl]-2,6-di(butan-2-yl)aniline.
| Compound Name | 4-[4-[4-amino-3,5-di(butan-2-yl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutyl]-2,6-di(butan-2-yl)aniline |
|---|---|
| PubChem CID | 172550400 |
| Molecular Formula | C32H44F8N2 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.34 |
| IUPAC Name | 4-[4-[4-amino-3,5-di(butan-2-yl)phenyl]-1,1,2,2,3,3,4,4-octafluorobutyl]-2,6-di(butan-2-yl)aniline |
| SMILES | CCC(C)c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2cc(C(C)CC)c(N)c(C(C)CC)c2)cc(C(C)CC)c1N |
| InChI | InChI=1S/C32H44F8N2/c1-9-17(5)23-13-21(14-24(27(23)41)18(6)10-2)29(33,34)31(37,38)32(39,40)30(35,36)22-15-25(19(7)11-3)28(42)26(16-22)20(8)12-4/h13-20H,9-12,41-42H2,1-8H3 |
| InChIKey | ACQABUCXMGCCRJ-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|